mirror of
https://github.com/nuxt/nuxt.git
synced 2024-12-03 19:07:15 +00:00
433 lines
14 KiB
Markdown
433 lines
14 KiB
Markdown
---
|
|
title: "pages"
|
|
description: "Nuxt provides file-based routing to create routes within your web application."
|
|
head.title: "pages/"
|
|
navigation.icon: i-ph-folder
|
|
---
|
|
|
|
::note
|
|
To reduce your application's bundle size, this directory is **optional**, meaning that [`vue-router`](https://router.vuejs.org) won't be included if you only use [`app.vue`](/docs/guide/directory-structure/app). To force the pages system, set `pages: true` in `nuxt.config` or have a [`app/router.options.ts`](/docs/guide/recipes/custom-routing#using-approuteroptions).
|
|
::
|
|
|
|
## Usage
|
|
|
|
Pages are Vue components and can have any [valid extension](/docs/api/configuration/nuxt-config#extensions) that Nuxt supports (by default `.vue`, `.js`, `.jsx`, `.mjs`, `.ts` or `.tsx`).
|
|
|
|
Nuxt will automatically create a route for every page in your `~/pages/` directory.
|
|
|
|
::code-group
|
|
|
|
```vue [pages/index.vue]
|
|
<template>
|
|
<h1>Index page</h1>
|
|
</template>
|
|
```
|
|
|
|
```ts twoslash [pages/index.ts]
|
|
// https://vuejs.org/guide/extras/render-function.html
|
|
export default defineComponent({
|
|
render () {
|
|
return h('h1', 'Index page')
|
|
}
|
|
})
|
|
```
|
|
|
|
```tsx twoslash [pages/index.tsx]
|
|
// https://nuxt.com/docs/examples/advanced/jsx
|
|
// https://vuejs.org/guide/extras/render-function.html#jsx-tsx
|
|
export default defineComponent({
|
|
render () {
|
|
return <h1>Index page</h1>
|
|
}
|
|
})
|
|
```
|
|
|
|
::
|
|
|
|
The `pages/index.vue` file will be mapped to the `/` route of your application.
|
|
|
|
If you are using [`app.vue`](/docs/guide/directory-structure/app), make sure to use the [`<NuxtPage/>`](/docs/api/components/nuxt-page) component to display the current page:
|
|
|
|
```vue [app.vue]
|
|
<template>
|
|
<div>
|
|
<!-- Markup shared across all pages, ex: NavBar -->
|
|
<NuxtPage />
|
|
</div>
|
|
</template>
|
|
```
|
|
|
|
Pages **must have a single root element** to allow [route transitions](/docs/getting-started/transitions) between pages. HTML comments are considered elements as well.
|
|
|
|
This means that when the route is server-rendered, or statically generated, you will be able to see its contents correctly, but when you navigate towards that route during client-side navigation the transition between routes will fail and you'll see that the route will not be rendered.
|
|
|
|
Here are some examples to illustrate what a page with a single root element looks like:
|
|
|
|
::code-group
|
|
|
|
```vue [pages/working.vue]
|
|
<template>
|
|
<div>
|
|
<!-- This page correctly has only one single root element -->
|
|
Page content
|
|
</div>
|
|
</template>
|
|
```
|
|
|
|
```vue [pages/bad-1.vue]
|
|
<template>
|
|
<!-- This page will not render when route changes during client side navigation, because of this comment -->
|
|
<div>Page content</div>
|
|
</template>
|
|
```
|
|
|
|
```vue [pages/bad-2.vue]
|
|
<template>
|
|
<div>This page</div>
|
|
<div>Has more than one root element</div>
|
|
<div>And will not render when route changes during client side navigation</div>
|
|
</template>
|
|
```
|
|
|
|
::
|
|
|
|
## Dynamic Routes
|
|
|
|
If you place anything within square brackets, it will be turned into a [dynamic route](https://router.vuejs.org/guide/essentials/dynamic-matching.html) parameter. You can mix and match multiple parameters and even non-dynamic text within a file name or directory.
|
|
|
|
If you want a parameter to be _optional_, you must enclose it in double square brackets - for example, `~/pages/[[slug]]/index.vue` or `~/pages/[[slug]].vue` will match both `/` and `/test`.
|
|
|
|
```bash [Directory Structure]
|
|
-| pages/
|
|
---| index.vue
|
|
---| users-[group]/
|
|
-----| [id].vue
|
|
```
|
|
|
|
Given the example above, you can access group/id within your component via the `$route` object:
|
|
|
|
```vue [pages/users-[group\\]/[id\\].vue]
|
|
<template>
|
|
<p>{{ $route.params.group }} - {{ $route.params.id }}</p>
|
|
</template>
|
|
```
|
|
|
|
Navigating to `/users-admins/123` would render:
|
|
|
|
```html
|
|
<p>admins - 123</p>
|
|
```
|
|
|
|
If you want to access the route using Composition API, there is a global [`useRoute`](/docs/api/composables/use-route) function that will allow you to access the route just like `this.$route` in the Options API.
|
|
|
|
```vue twoslash
|
|
<script setup lang="ts">
|
|
const route = useRoute()
|
|
|
|
if (route.params.group === 'admins' && !route.params.id) {
|
|
console.log('Warning! Make sure user is authenticated!')
|
|
}
|
|
</script>
|
|
```
|
|
|
|
::note
|
|
Named parent routes will take priority over nested dynamic routes. For the `/foo/hello` route, `~/pages/foo.vue` will take priority over `~/pages/foo/[slug].vue`. :br Use `~/pages/foo/index.vue` and `~/pages/foo/[slug].vue` to match `/foo` and `/foo/hello` with different pages,.
|
|
::
|
|
|
|
## Catch-all Route
|
|
|
|
If you need a catch-all route, you create it by using a file named like `[...slug].vue`. This will match _all_ routes under that path.
|
|
|
|
```vue [pages/[...slug\\].vue]
|
|
<template>
|
|
<p>{{ $route.params.slug }}</p>
|
|
</template>
|
|
```
|
|
|
|
Navigating to `/hello/world` would render:
|
|
|
|
```html
|
|
<p>["hello", "world"]</p>
|
|
```
|
|
|
|
## Nested Routes
|
|
|
|
It is possible to display [nested routes](https://next.router.vuejs.org/guide/essentials/nested-routes.html) with `<NuxtPage>`.
|
|
|
|
Example:
|
|
|
|
```bash [Directory Structure]
|
|
-| pages/
|
|
---| parent/
|
|
-----| child.vue
|
|
---| parent.vue
|
|
```
|
|
|
|
This file tree will generate these routes:
|
|
|
|
```js
|
|
[
|
|
{
|
|
path: '/parent',
|
|
component: '~/pages/parent.vue',
|
|
name: 'parent',
|
|
children: [
|
|
{
|
|
path: 'child',
|
|
component: '~/pages/parent/child.vue',
|
|
name: 'parent-child'
|
|
}
|
|
]
|
|
}
|
|
]
|
|
```
|
|
|
|
To display the `child.vue` component, you have to insert the `<NuxtPage>` component inside `pages/parent.vue`:
|
|
|
|
```vue {}[pages/parent.vue]
|
|
<template>
|
|
<div>
|
|
<h1>I am the parent view</h1>
|
|
<NuxtPage :foobar="123" />
|
|
</div>
|
|
</template>
|
|
```
|
|
|
|
```vue {}[pages/parent/child.vue]
|
|
<script setup lang="ts">
|
|
const props = defineProps(['foobar'])
|
|
|
|
console.log(props.foobar)
|
|
</script>
|
|
```
|
|
|
|
### Child Route Keys
|
|
|
|
If you want more control over when the `<NuxtPage>` component is re-rendered (for example, for transitions), you can either pass a string or function via the `pageKey` prop, or you can define a `key` value via `definePageMeta`:
|
|
|
|
```vue {}[pages/parent.vue]
|
|
<template>
|
|
<div>
|
|
<h1>I am the parent view</h1>
|
|
<NuxtPage :page-key="route => route.fullPath" />
|
|
</div>
|
|
</template>
|
|
```
|
|
|
|
Or alternatively:
|
|
|
|
```vue twoslash {}[pages/parent/child.vue]
|
|
<script setup lang="ts">
|
|
definePageMeta({
|
|
key: route => route.fullPath
|
|
})
|
|
</script>
|
|
```
|
|
|
|
:link-example{to="/docs/examples/routing/pages"}
|
|
|
|
## Route Groups
|
|
|
|
In some cases, you may want to group a set of routes together in a way which doesn't affect file-based routing. For this purpose, you can put files in a folder which is wrapped in parentheses - `(` and `)`.
|
|
|
|
For example:
|
|
|
|
```bash [Directory structure]
|
|
-| pages/
|
|
---| index.vue
|
|
---| (marketing)/
|
|
-----| about.vue
|
|
-----| contact.vue
|
|
```
|
|
|
|
This will produce `/`, `/about` and `/contact` pages in your app. The `marketing` group is ignored for purposes of your URL structure.
|
|
|
|
## Page Metadata
|
|
|
|
You might want to define metadata for each route in your app. You can do this using the `definePageMeta` macro, which will work both in `<script>` and in `<script setup>`:
|
|
|
|
```vue twoslash
|
|
<script setup lang="ts">
|
|
definePageMeta({
|
|
title: 'My home page'
|
|
})
|
|
</script>
|
|
```
|
|
|
|
This data can then be accessed throughout the rest of your app from the `route.meta` object.
|
|
|
|
```vue twoslash
|
|
<script setup lang="ts">
|
|
const route = useRoute()
|
|
|
|
console.log(route.meta.title) // My home page
|
|
</script>
|
|
```
|
|
|
|
If you are using nested routes, the page metadata from all these routes will be merged into a single object. For more on route meta, see the [vue-router docs](https://router.vuejs.org/guide/advanced/meta.html#route-meta-fields).
|
|
|
|
Much like `defineEmits` or `defineProps` (see [Vue docs](https://vuejs.org/api/sfc-script-setup.html#defineprops-defineemits)), `definePageMeta` is a **compiler macro**. It will be compiled away so you cannot reference it within your component. Instead, the metadata passed to it will be hoisted out of the component. Therefore, the page meta object cannot reference the component (or values defined on the component). However, it can reference imported bindings.
|
|
|
|
```vue
|
|
<script setup lang="ts">
|
|
import { someData } from '~/utils/example'
|
|
|
|
const title = ref('')
|
|
|
|
definePageMeta({
|
|
title, // This will create an error
|
|
someData
|
|
})
|
|
</script>
|
|
```
|
|
|
|
### Special Metadata
|
|
|
|
Of course, you are welcome to define metadata for your own use throughout your app. But some metadata defined with `definePageMeta` has a particular purpose:
|
|
|
|
#### `alias`
|
|
|
|
You can define page aliases. They allow you to access the same page from different paths. It can be either a string or an array of strings as defined [here](https://router.vuejs.org/guide/essentials/redirect-and-alias.html#Alias) on vue-router documentation.
|
|
|
|
#### `keepalive`
|
|
|
|
Nuxt will automatically wrap your page in [the Vue `<KeepAlive>` component](https://vuejs.org/guide/built-ins/keep-alive.html#keepalive) if you set `keepalive: true` in your `definePageMeta`. This might be useful to do, for example, in a parent route that has dynamic child routes, if you want to preserve page state across route changes.
|
|
|
|
When your goal is to preserve state for parent routes use this syntax: `<NuxtPage keepalive />`. You can also set props to be passed to `<KeepAlive>` (see a full list [here](https://vuejs.org/api/built-in-components.html#keepalive)).
|
|
|
|
You can set a default value for this property [in your `nuxt.config`](/docs/api/nuxt-config#keepalive).
|
|
|
|
#### `key`
|
|
|
|
[See above](#child-route-keys).
|
|
|
|
#### `layout`
|
|
|
|
You can define the layout used to render the route. This can be either false (to disable any layout), a string or a ref/computed, if you want to make it reactive in some way. [More about layouts](/docs/guide/directory-structure/layouts).
|
|
|
|
#### `layoutTransition` and `pageTransition`
|
|
|
|
You can define transition properties for the `<transition>` component that wraps your pages and layouts, or pass `false` to disable the `<transition>` wrapper for that route. You can see a list of options that can be passed [here](https://vuejs.org/api/built-in-components.html#transition) or read [more about how transitions work](https://vuejs.org/guide/built-ins/transition.html#transition).
|
|
|
|
You can set default values for these properties [in your `nuxt.config`](/docs/api/nuxt-config#layouttransition).
|
|
|
|
#### `middleware`
|
|
|
|
You can define middleware to apply before loading this page. It will be merged with all the other middleware used in any matching parent/child routes. It can be a string, a function (an anonymous/inlined middleware function following [the global before guard pattern](https://router.vuejs.org/guide/advanced/navigation-guards.html#global-before-guards)), or an array of strings/functions. [More about named middleware](/docs/guide/directory-structure/middleware).
|
|
|
|
#### `name`
|
|
|
|
You may define a name for this page's route.
|
|
|
|
#### `path`
|
|
|
|
You may define a path matcher, if you have a more complex pattern than can be expressed with the file name. See [the `vue-router` docs](https://router.vuejs.org/guide/essentials/route-matching-syntax.html#custom-regex-in-params) for more information.
|
|
|
|
#### `props`
|
|
|
|
Allows accessing the route `params` as props passed to the page component. See[the `vue-router` docs](https://router.vuejs.org/guide/essentials/passing-props) for more information.
|
|
|
|
### Typing Custom Metadata
|
|
|
|
If you add custom metadata for your pages, you may wish to do so in a type-safe way. It is possible to augment the type of the object accepted by `definePageMeta`:
|
|
|
|
```ts [index.d.ts]
|
|
declare module '#app' {
|
|
interface PageMeta {
|
|
pageType?: string
|
|
}
|
|
}
|
|
|
|
// It is always important to ensure you import/export something when augmenting a type
|
|
export {}
|
|
```
|
|
|
|
## Navigation
|
|
|
|
To navigate between pages of your app, you should use the [`<NuxtLink>`](/docs/api/components/nuxt-link) component.
|
|
|
|
This component is included with Nuxt and therefore you don't have to import it as you do with other components.
|
|
|
|
A simple link to the `index.vue` page in your `pages` folder:
|
|
|
|
```vue
|
|
<template>
|
|
<NuxtLink to="/">Home page</NuxtLink>
|
|
</template>
|
|
```
|
|
|
|
::read-more{to="/docs/api/components/nuxt-link"}
|
|
Learn more about `<NuxtLink>` usage.
|
|
::
|
|
|
|
## Programmatic Navigation
|
|
|
|
Nuxt allows programmatic navigation through the `navigateTo()` utility method. Using this utility method, you will be able to programmatically navigate the user in your app. This is great for taking input from the user and navigating them dynamically throughout your application. In this example, we have a simple method called `navigate()` that gets called when the user submits a search form.
|
|
|
|
::note
|
|
Ensure to always `await` on `navigateTo` or chain its result by returning from functions.
|
|
::
|
|
|
|
```vue twoslash
|
|
<script setup lang="ts">
|
|
const name = ref('');
|
|
const type = ref(1);
|
|
|
|
function navigate(){
|
|
return navigateTo({
|
|
path: '/search',
|
|
query: {
|
|
name: name.value,
|
|
type: type.value
|
|
}
|
|
})
|
|
}
|
|
</script>
|
|
```
|
|
|
|
## Client-Only Pages
|
|
|
|
You can define a page as [client only](/docs/guide/directory-structure/components#client-components) by giving it a `.client.vue` suffix. None of the content of this page will be rendered on the server.
|
|
|
|
## Server-Only Pages
|
|
|
|
You can define a page as [server only](/docs/guide/directory-structure/components#server-components) by giving it a `.server.vue` suffix. While you will be able to navigate to the page using client-side navigation, controlled by `vue-router`, it will be rendered with a server component automatically, meaning the code required to render the page will not be in your client-side bundle.
|
|
|
|
::alert{type=warning}
|
|
Server-only pages must have a single root element. (HTML comments are considered elements as well.)
|
|
::
|
|
|
|
## Custom Routing
|
|
|
|
As your app gets bigger and more complex, your routing might require more flexibility. For this reason, Nuxt directly exposes the router, routes and router options for customization in different ways.
|
|
|
|
:read-more{to="/docs/guide/recipes/custom-routing"}
|
|
|
|
## Multiple Pages Directories
|
|
|
|
By default, all your pages should be in one `pages` directory at the root of your project.
|
|
|
|
However, you can use [Nuxt Layers](/docs/getting-started/layers) to create groupings of your app's pages:
|
|
|
|
```bash [Directory Structure]
|
|
-| some-app/
|
|
---| nuxt.config.ts
|
|
---| pages/
|
|
-----| app-page.vue
|
|
-| nuxt.config.ts
|
|
```
|
|
|
|
```ts twoslash [some-app/nuxt.config.ts]
|
|
// some-app/nuxt.config.ts
|
|
export default defineNuxtConfig({
|
|
})
|
|
```
|
|
|
|
```ts twoslash [nuxt.config.ts]
|
|
export default defineNuxtConfig({
|
|
extends: ['./some-app'],
|
|
})
|
|
```
|
|
|
|
:read-more{to="/docs/guide/going-further/layers"}
|