mirror of
https://github.com/nuxt/nuxt.git
synced 2025-02-13 12:18:15 +00:00
151 lines
4.5 KiB
Markdown
151 lines
4.5 KiB
Markdown
---
|
|
title: "<NuxtPage>"
|
|
description: The <NuxtPage> component is required to display pages located in the pages/ directory.
|
|
links:
|
|
- label: Source
|
|
icon: i-simple-icons-github
|
|
to: https://github.com/nuxt/nuxt/blob/main/packages/nuxt/src/pages/runtime/page.ts
|
|
size: xs
|
|
---
|
|
|
|
`<NuxtPage>` is a built-in component that comes with Nuxt. It lets you display top-level or nested pages located in the [`pages/`](/docs/guide/directory-structure/pages) directory.
|
|
|
|
::note
|
|
`<NuxtPage>` is a wrapper around [`<RouterView>`](https://router.vuejs.org/api/interfaces/RouterViewProps.html#interface-routerviewprops) from Vue Router. It should be used instead of `<RouterView>` because the former takes additional care of internal states. Otherwise, `useRoute()` may return incorrect paths.
|
|
::
|
|
|
|
`<NuxtPage>` includes the following components:
|
|
|
|
```vue
|
|
<template>
|
|
<RouterView #default="{ Component }">
|
|
<!-- Optional, when using transitions -->
|
|
<Transition>
|
|
<!-- Optional, when using keep-alive -->
|
|
<KeepAlive>
|
|
<Suspense>
|
|
<component :is="Component" />
|
|
</Suspense>
|
|
</KeepAlive>
|
|
</Transition>
|
|
</RouterView>
|
|
</template>
|
|
```
|
|
|
|
By default, Nuxt does not enable `<Transition>` and `<KeepAlive>`. You can enable them in the nuxt.config file or by setting the `transition` and `keepalive` properties on `<NuxtPage>`. If you want to define a specific page, you can set it in `definePageMeta` in the page component.
|
|
|
|
::warning
|
|
If you enable `<Transition>` in your page component, ensure that the page has a single root element.
|
|
::
|
|
|
|
## Props
|
|
|
|
- `name`: tells `<RouterView>` to render the component with the corresponding name in the matched route record's components option.
|
|
- type: `string`
|
|
- `route`: route location that has all of its components resolved.
|
|
- type: `RouteLocationNormalized`
|
|
- `pageKey`: control when the `NuxtPage` component is re-rendered.
|
|
- type: `string` or `function`
|
|
- `transition`: define global transitions for all pages rendered with the `NuxtPage` component.
|
|
- type: `boolean` or [`TransitionProps`](https://vuejs.org/api/built-in-components#transition)
|
|
- `keepalive`: control state preservation of pages rendered with the `NuxtPage` component.
|
|
- type: `boolean` or [`KeepAliveProps`](https://vuejs.org/api/built-in-components#keepalive)
|
|
|
|
::tip
|
|
Nuxt automatically resolves the `name` and `route` by scanning and rendering all Vue component files found in the `/pages` directory.
|
|
::
|
|
|
|
## Example
|
|
|
|
For example, if you pass a key that never changes, the `<NuxtPage>` component will be rendered only once - when it is first mounted.
|
|
|
|
```vue [app.vue]
|
|
<template>
|
|
<NuxtPage page-key="static" />
|
|
</template>
|
|
```
|
|
|
|
You can also use a dynamic key based on the current route:
|
|
|
|
```html
|
|
<NuxtPage :page-key="route => route.fullPath" />
|
|
```
|
|
|
|
::warning
|
|
Don't use `$route` object here as it can cause problems with how `<NuxtPage>` renders pages with `<Suspense>`.
|
|
::
|
|
|
|
Alternatively, `pageKey` can be passed as a `key` value via [`definePageMeta`](/docs/api/utils/define-page-meta) from the `<script>` section of your Vue component in the `/pages` directory.
|
|
|
|
```vue [pages/my-page.vue]
|
|
<script setup lang="ts">
|
|
definePageMeta({
|
|
key: route => route.fullPath
|
|
})
|
|
</script>
|
|
```
|
|
|
|
:link-example{to="/docs/examples/routing/pages"}
|
|
|
|
## Page's Ref
|
|
|
|
To get the `ref` of a page component, access it through `ref.value.pageRef`
|
|
|
|
````vue [app.vue]
|
|
<script setup lang="ts">
|
|
const page = ref()
|
|
|
|
function logFoo () {
|
|
page.value.pageRef.foo()
|
|
}
|
|
</script>
|
|
|
|
<template>
|
|
<NuxtPage ref="page" />
|
|
</template>
|
|
````
|
|
|
|
````vue [my-page.vue]
|
|
<script setup lang="ts">
|
|
const foo = () => {
|
|
console.log('foo method called')
|
|
}
|
|
|
|
defineExpose({
|
|
foo,
|
|
})
|
|
</script>
|
|
````
|
|
|
|
## Custom Props
|
|
|
|
`<NuxtPage>` also accepts custom props that you may need to pass further down the hierarchy.
|
|
|
|
For example, in the below example, the value of `foobar` will be passed to the `NuxtPage` component and then to the page components.
|
|
|
|
```vue [app.vue]
|
|
<template>
|
|
<NuxtPage :foobar="123" />
|
|
</template>
|
|
```
|
|
|
|
We can access the `foobar` prop in the page component:
|
|
|
|
```vue [pages/page.vue]
|
|
<script setup lang="ts">
|
|
const props = defineProps<{ foobar: number }>()
|
|
|
|
console.log(props.foobar) // Outputs: 123
|
|
```
|
|
|
|
If you have not defined the prop with `defineProps`, any props passed down to `NuxtPage` can still be accessed directly from the page `attrs`:
|
|
|
|
```vue [pages/page.vue]
|
|
<script setup lang="ts">
|
|
const attrs = useAttrs()
|
|
console.log(attrs.foobar) // Outputs: 123
|
|
</script>
|
|
```
|
|
|
|
:read-more{to="/docs/guide/directory-structure/pages"}
|